C21H25ClN6 — CID 88629359
4-[(E)-[3-[(E)-[4-(dimethylamino)phenyl]methylideneamino]imidazol-3-ium-1-yl]iminomethyl]-N,N-dimethylaniline chloride (PubChem CID 88629359) has the molecular formula C21H25ClN6 and a molecular weight of 396.93 g/mol. Its IUPAC name is 4-[(E)-[3-[(E)-[4-(dimethylamino)phenyl]methylideneamino]imidazol-3-ium-1-yl]iminomethyl]-N,N-dimethylaniline chloride.
| Compound Name | 4-[(E)-[3-[(E)-[4-(dimethylamino)phenyl]methylideneamino]imidazol-3-ium-1-yl]iminomethyl]-N,N-dimethylaniline chloride |
|---|---|
| PubChem CID | 88629359 |
| Molecular Formula | C21H25ClN6 |
| Molecular Weight | 396.93 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 4-[(E)-[3-[(E)-[4-(dimethylamino)phenyl]methylideneamino]imidazol-3-ium-1-yl]iminomethyl]-N,N-dimethylaniline chloride |
| SMILES | CN(C)c1ccc(/C=N/n2cc[n+](/N=C/c3ccc(N(C)C)cc3)c2)cc1.[Cl-] |
| InChI | InChI=1S/C21H25N6.ClH/c1-24(2)20-9-5-18(6-10-20)15-22-26-13-14-27(17-26)23-16-19-7-11-21(12-8-19)25(3)4;/h5-17H,1-4H3;1H/q+1;/p-1/b22-15+,23-16+; |
| InChIKey | CSAKFYLUALLCPL-YXEBPMGASA-M |
| XLogP | -0.32 |
| TPSA | 40.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.93 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|