C21H23N4+ — CID 54169168
N-[3-(benzylideneamino)-2-butylimidazol-3-ium-1-yl]-1-phenylmethanimine (PubChem CID 54169168) has the molecular formula C21H23N4+ and a molecular weight of 331.44 g/mol. Its IUPAC name is N-[3-(benzylideneamino)-2-butylimidazol-3-ium-1-yl]-1-phenylmethanimine.
| Compound Name | N-[3-(benzylideneamino)-2-butylimidazol-3-ium-1-yl]-1-phenylmethanimine |
|---|---|
| PubChem CID | 54169168 |
| Molecular Formula | C21H23N4+ |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | N-[3-(benzylideneamino)-2-butylimidazol-3-ium-1-yl]-1-phenylmethanimine |
| SMILES | CCCCc1n(N=Cc2ccccc2)cc[n+]1N=Cc1ccccc1 |
| InChI | InChI=1S/C21H23N4/c1-2-3-14-21-24(22-17-19-10-6-4-7-11-19)15-16-25(21)23-18-20-12-8-5-9-13-20/h4-13,15-18H,2-3,14H2,1H3/q+1 |
| InChIKey | OTULKXINTCPKLW-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|