C16H16ClFN2O2S — CID 22168969
2-[2-(4-chloro-5-fluoro-2-nitrophenyl)sulfanylphenyl]-N,N-dimethylethanamine (PubChem CID 22168969) has the molecular formula C16H16ClFN2O2S and a molecular weight of 354.83 g/mol. Its IUPAC name is 2-[2-(4-chloro-5-fluoro-2-nitrophenyl)sulfanylphenyl]-N,N-dimethylethanamine.
| Compound Name | 2-[2-(4-chloro-5-fluoro-2-nitrophenyl)sulfanylphenyl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 22168969 |
| Molecular Formula | C16H16ClFN2O2S |
| Molecular Weight | 354.83 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | 2-[2-(4-chloro-5-fluoro-2-nitrophenyl)sulfanylphenyl]-N,N-dimethylethanamine |
| SMILES | CN(C)CCc1ccccc1Sc1cc(F)c(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H16ClFN2O2S/c1-19(2)8-7-11-5-3-4-6-15(11)23-16-10-13(18)12(17)9-14(16)20(21)22/h3-6,9-10H,7-8H2,1-2H3 |
| InChIKey | JTTQNODYUGYBPL-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.83 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|