C16H17NO4 — CID 22172773
quinolin-7-yl 3,5-dihydroxyhept-6-enoate (PubChem CID 22172773) has the molecular formula C16H17NO4 and a molecular weight of 287.32 g/mol. Its IUPAC name is quinolin-7-yl 3,5-dihydroxyhept-6-enoate.
| Compound Name | quinolin-7-yl 3,5-dihydroxyhept-6-enoate |
|---|---|
| PubChem CID | 22172773 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | quinolin-7-yl 3,5-dihydroxyhept-6-enoate |
| SMILES | C=CC(O)CC(O)CC(=O)Oc1ccc2cccnc2c1 |
| InChI | InChI=1S/C16H17NO4/c1-2-12(18)8-13(19)9-16(20)21-14-6-5-11-4-3-7-17-15(11)10-14/h2-7,10,12-13,18-19H,1,8-9H2 |
| InChIKey | JCEKJQBGQDALGG-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|