C24H18F6N2O3 — CID 22179330
5-[[3,5-bis(trifluoromethyl)phenyl]methyl]-10-oxido-7-phenyl-3,4-dihydro-2H-pyrido[2,3-b][1,5]oxazocin-10-ium-6-one (PubChem CID 22179330) has the molecular formula C24H18F6N2O3 and a molecular weight of 496.41 g/mol. Its IUPAC name is 5-[[3,5-bis(trifluoromethyl)phenyl]methyl]-10-oxido-7-phenyl-3,4-dihydro-2H-pyrido[2,3-b][1,5]oxazocin-10-ium-6-one.
| Compound Name | 5-[[3,5-bis(trifluoromethyl)phenyl]methyl]-10-oxido-7-phenyl-3,4-dihydro-2H-pyrido[2,3-b][1,5]oxazocin-10-ium-6-one |
|---|---|
| PubChem CID | 22179330 |
| Molecular Formula | C24H18F6N2O3 |
| Molecular Weight | 496.41 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | 5-[[3,5-bis(trifluoromethyl)phenyl]methyl]-10-oxido-7-phenyl-3,4-dihydro-2H-pyrido[2,3-b][1,5]oxazocin-10-ium-6-one |
| SMILES | O=C1c2c(-c3ccccc3)cc[n+]([O-])c2OCCCN1Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H18F6N2O3/c25-23(26,27)17-11-15(12-18(13-17)24(28,29)30)14-31-8-4-10-35-22-20(21(31)33)19(7-9-32(22)34)16-5-2-1-3-6-16/h1-3,5-7,9,11-13H,4,8,10,14H2 |
| InChIKey | QPNSCJHTSSKODF-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.41 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|