C24H20F6N2O — CID 87679499
5-[[3,5-bis(trifluoromethyl)phenyl]methyl]-7-phenyl-2,3,4,6-tetrahydropyrido[2,3-b][1,5]oxazocine (PubChem CID 87679499) has the molecular formula C24H20F6N2O and a molecular weight of 466.43 g/mol. Its IUPAC name is 5-[[3,5-bis(trifluoromethyl)phenyl]methyl]-7-phenyl-2,3,4,6-tetrahydropyrido[2,3-b][1,5]oxazocine.
| Compound Name | 5-[[3,5-bis(trifluoromethyl)phenyl]methyl]-7-phenyl-2,3,4,6-tetrahydropyrido[2,3-b][1,5]oxazocine |
|---|---|
| PubChem CID | 87679499 |
| Molecular Formula | C24H20F6N2O |
| Molecular Weight | 466.43 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | 5-[[3,5-bis(trifluoromethyl)phenyl]methyl]-7-phenyl-2,3,4,6-tetrahydropyrido[2,3-b][1,5]oxazocine |
| SMILES | FC(F)(F)c1cc(CN2CCCOc3nccc(-c4ccccc4)c3C2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H20F6N2O/c25-23(26,27)18-11-16(12-19(13-18)24(28,29)30)14-32-9-4-10-33-22-21(15-32)20(7-8-31-22)17-5-2-1-3-6-17/h1-3,5-8,11-13H,4,9-10,14-15H2 |
| InChIKey | DUUCGMFOBZASHB-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.43 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |