C25H20F6N2O2 — CID 87300617
[3,5-bis(trifluoromethyl)phenyl]-(8-phenyl-3,4,5,7-tetrahydro-2H-pyrido[2,3-b][1,5]oxazonin-6-yl)methanone (PubChem CID 87300617) has the molecular formula C25H20F6N2O2 and a molecular weight of 494.44 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]-(8-phenyl-3,4,5,7-tetrahydro-2H-pyrido[2,3-b][1,5]oxazonin-6-yl)methanone.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]-(8-phenyl-3,4,5,7-tetrahydro-2H-pyrido[2,3-b][1,5]oxazonin-6-yl)methanone |
|---|---|
| PubChem CID | 87300617 |
| Molecular Formula | C25H20F6N2O2 |
| Molecular Weight | 494.44 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]-(8-phenyl-3,4,5,7-tetrahydro-2H-pyrido[2,3-b][1,5]oxazonin-6-yl)methanone |
| SMILES | O=C(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)N1CCCCOc2nccc(-c3ccccc3)c2C1 |
| InChI | InChI=1S/C25H20F6N2O2/c26-24(27,28)18-12-17(13-19(14-18)25(29,30)31)23(34)33-10-4-5-11-35-22-21(15-33)20(8-9-32-22)16-6-2-1-3-7-16/h1-3,6-9,12-14H,4-5,10-11,15H2 |
| InChIKey | POZYYNRIDUZXNB-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.44 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |