C31H31F6N5O3 — CID 23594869
2-(4-acetyl-1,4-diazepan-1-yl)-6-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4-(2-methylphenyl)-8,9-dihydro-7H-pyrimido[4,5-b][1,5]oxazocin-5-one (PubChem CID 23594869) has the molecular formula C31H31F6N5O3 and a molecular weight of 635.61 g/mol. Its IUPAC name is 2-(4-acetyl-1,4-diazepan-1-yl)-6-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4-(2-methylphenyl)-8,9-dihydro-7H-pyrimido[4,5-b][1,5]oxazocin-5-one.
| Compound Name | 2-(4-acetyl-1,4-diazepan-1-yl)-6-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4-(2-methylphenyl)-8,9-dihydro-7H-pyrimido[4,5-b][1,5]oxazocin-5-one |
|---|---|
| PubChem CID | 23594869 |
| Molecular Formula | C31H31F6N5O3 |
| Molecular Weight | 635.61 g/mol |
| Exact Mass | 635.23 |
| IUPAC Name | 2-(4-acetyl-1,4-diazepan-1-yl)-6-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4-(2-methylphenyl)-8,9-dihydro-7H-pyrimido[4,5-b][1,5]oxazocin-5-one |
| SMILES | CC(=O)N1CCCN(c2nc3c(c(-c4ccccc4C)n2)C(=O)N(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)CCCO3)CC1 |
| InChI | InChI=1S/C31H31F6N5O3/c1-19-7-3-4-8-24(19)26-25-27(39-29(38-26)41-10-5-9-40(12-13-41)20(2)43)45-14-6-11-42(28(25)44)18-21-15-22(30(32,33)34)17-23(16-21)31(35,36)37/h3-4,7-8,15-17H,5-6,9-14,18H2,1-2H3 |
| InChIKey | YEPRBXUUGHOMFF-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 78.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.61 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |