C12H10F2N2O2S — CID 22179365
[4-(3,4-difluorophenyl)sulfonylphenyl]hydrazine (PubChem CID 22179365) has the molecular formula C12H10F2N2O2S and a molecular weight of 284.29 g/mol. Its IUPAC name is [4-(3,4-difluorophenyl)sulfonylphenyl]hydrazine.
| Compound Name | [4-(3,4-difluorophenyl)sulfonylphenyl]hydrazine |
|---|---|
| PubChem CID | 22179365 |
| Molecular Formula | C12H10F2N2O2S |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | [4-(3,4-difluorophenyl)sulfonylphenyl]hydrazine |
| SMILES | NNc1ccc(S(=O)(=O)c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C12H10F2N2O2S/c13-11-6-5-10(7-12(11)14)19(17,18)9-3-1-8(16-15)2-4-9/h1-7,16H,15H2 |
| InChIKey | ASZCCXAGYIIBOY-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|