C10H7N7O4 — CID 2218339
2-methyl-3-nitro-6-(4-nitro-1H-pyrazol-5-yl)pyrazolo[1,5-a]pyrimidine (PubChem CID 2218339) has the molecular formula C10H7N7O4 and a molecular weight of 289.21 g/mol. Its IUPAC name is 2-methyl-3-nitro-6-(4-nitro-1H-pyrazol-5-yl)pyrazolo[1,5-a]pyrimidine.
| Compound Name | 2-methyl-3-nitro-6-(4-nitro-1H-pyrazol-5-yl)pyrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 2218339 |
| Molecular Formula | C10H7N7O4 |
| Molecular Weight | 289.21 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 2-methyl-3-nitro-6-(4-nitro-1H-pyrazol-5-yl)pyrazolo[1,5-a]pyrimidine |
| SMILES | Cc1nn2cc(-c3[nH]ncc3[N+](=O)[O-])cnc2c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H7N7O4/c1-5-9(17(20)21)10-11-2-6(4-15(10)14-5)8-7(16(18)19)3-12-13-8/h2-4H,1H3,(H,12,13) |
| InChIKey | LWXWECRXCMLYDI-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 145.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.21 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|