C24H36N6O6 — CID 22186244
1,3,5-tris(1-isocyanatohexyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 22186244) has the molecular formula C24H36N6O6 and a molecular weight of 504.59 g/mol. Its IUPAC name is 1,3,5-tris(1-isocyanatohexyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3,5-tris(1-isocyanatohexyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 22186244 |
| Molecular Formula | C24H36N6O6 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.27 |
| IUPAC Name | 1,3,5-tris(1-isocyanatohexyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | CCCCCC(N=C=O)n1c(=O)n(C(CCCCC)N=C=O)c(=O)n(C(CCCCC)N=C=O)c1=O |
| InChI | InChI=1S/C24H36N6O6/c1-4-7-10-13-19(25-16-31)28-22(34)29(20(26-17-32)14-11-8-5-2)24(36)30(23(28)35)21(27-18-33)15-12-9-6-3/h19-21H,4-15H2,1-3H3 |
| InChIKey | HGRBYJMJLJMHRH-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 154.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|