C11H17N5OS — CID 22194063
2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-N-(1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 22194063) has the molecular formula C11H17N5OS and a molecular weight of 267.36 g/mol. Its IUPAC name is 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-N-(1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-N-(1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 22194063 |
| Molecular Formula | C11H17N5OS |
| Molecular Weight | 267.36 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-N-(1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | O=C(CN1CCN2CCCC2C1)Nc1nncs1 |
| InChI | InChI=1S/C11H17N5OS/c17-10(13-11-14-12-8-18-11)7-15-4-5-16-3-1-2-9(16)6-15/h8-9H,1-7H2,(H,13,14,17) |
| InChIKey | OAOQTUHTUYBLPE-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.36 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |