C18H20N2O2S — CID 22200841
1-(2,3,4,5,6-pentamethylphenyl)sulfonylbenzimidazole (PubChem CID 22200841) has the molecular formula C18H20N2O2S and a molecular weight of 328.44 g/mol. Its IUPAC name is 1-(2,3,4,5,6-pentamethylphenyl)sulfonylbenzimidazole.
| Compound Name | 1-(2,3,4,5,6-pentamethylphenyl)sulfonylbenzimidazole |
|---|---|
| PubChem CID | 22200841 |
| Molecular Formula | C18H20N2O2S |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 1-(2,3,4,5,6-pentamethylphenyl)sulfonylbenzimidazole |
| SMILES | Cc1c(C)c(C)c(S(=O)(=O)n2cnc3ccccc32)c(C)c1C |
| InChI | InChI=1S/C18H20N2O2S/c1-11-12(2)14(4)18(15(5)13(11)3)23(21,22)20-10-19-16-8-6-7-9-17(16)20/h6-10H,1-5H3 |
| InChIKey | DBKLVSIOQKJSAS-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |