C17H18N2O3S — CID 91669949
1-(5-ethoxy-2,4-dimethylphenyl)sulfonylbenzimidazole (PubChem CID 91669949) has the molecular formula C17H18N2O3S and a molecular weight of 330.41 g/mol. Its IUPAC name is 1-(5-ethoxy-2,4-dimethylphenyl)sulfonylbenzimidazole.
| Compound Name | 1-(5-ethoxy-2,4-dimethylphenyl)sulfonylbenzimidazole |
|---|---|
| PubChem CID | 91669949 |
| Molecular Formula | C17H18N2O3S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 1-(5-ethoxy-2,4-dimethylphenyl)sulfonylbenzimidazole |
| SMILES | CCOc1cc(S(=O)(=O)n2cnc3ccccc32)c(C)cc1C |
| InChI | InChI=1S/C17H18N2O3S/c1-4-22-16-10-17(13(3)9-12(16)2)23(20,21)19-11-18-14-7-5-6-8-15(14)19/h5-11H,4H2,1-3H3 |
| InChIKey | TVDIYMGOUMMFCM-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |