C13H8Br2N2O2S — CID 2849375
1-(2,4-dibromophenyl)sulfonylbenzimidazole (PubChem CID 2849375) has the molecular formula C13H8Br2N2O2S and a molecular weight of 416.09 g/mol. Its IUPAC name is 1-(2,4-dibromophenyl)sulfonylbenzimidazole.
| Compound Name | 1-(2,4-dibromophenyl)sulfonylbenzimidazole |
|---|---|
| PubChem CID | 2849375 |
| Molecular Formula | C13H8Br2N2O2S |
| Molecular Weight | 416.09 g/mol |
| Exact Mass | 413.87 |
| IUPAC Name | 1-(2,4-dibromophenyl)sulfonylbenzimidazole |
| SMILES | O=S(=O)(c1ccc(Br)cc1Br)n1cnc2ccccc21 |
| InChI | InChI=1S/C13H8Br2N2O2S/c14-9-5-6-13(10(15)7-9)20(18,19)17-8-16-11-3-1-2-4-12(11)17/h1-8H |
| InChIKey | IVHNZAWTCUEBHD-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.09 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |