C21H17F4N5O2S — CID 22205620
3,5-dimethyl-1-phenyl-N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]pyrazole-4-sulfonamide (PubChem CID 22205620) has the molecular formula C21H17F4N5O2S and a molecular weight of 479.46 g/mol. Its IUPAC name is 3,5-dimethyl-1-phenyl-N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]pyrazole-4-sulfonamide.
| Compound Name | 3,5-dimethyl-1-phenyl-N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 22205620 |
| Molecular Formula | C21H17F4N5O2S |
| Molecular Weight | 479.46 g/mol |
| Exact Mass | 479.10 |
| IUPAC Name | 3,5-dimethyl-1-phenyl-N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]pyrazole-4-sulfonamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1S(=O)(=O)Nc1ccn(Cc2c(F)c(F)cc(F)c2F)n1 |
| InChI | InChI=1S/C21H17F4N5O2S/c1-12-21(13(2)30(26-12)14-6-4-3-5-7-14)33(31,32)28-18-8-9-29(27-18)11-15-19(24)16(22)10-17(23)20(15)25/h3-10H,11H2,1-2H3,(H,27,28) |
| InChIKey | POCFJBROPLVEDM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|