C16H12Cl2N4O4S — CID 22206393
N-[4-chloro-1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-2-nitrobenzenesulfonamide (PubChem CID 22206393) has the molecular formula C16H12Cl2N4O4S and a molecular weight of 427.27 g/mol. Its IUPAC name is N-[4-chloro-1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-2-nitrobenzenesulfonamide.
| Compound Name | N-[4-chloro-1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 22206393 |
| Molecular Formula | C16H12Cl2N4O4S |
| Molecular Weight | 427.27 g/mol |
| Exact Mass | 426.00 |
| IUPAC Name | N-[4-chloro-1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-2-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccccc1S(=O)(=O)Nc1nn(Cc2ccccc2Cl)cc1Cl |
| InChI | InChI=1S/C16H12Cl2N4O4S/c17-12-6-2-1-5-11(12)9-21-10-13(18)16(19-21)20-27(25,26)15-8-4-3-7-14(15)22(23)24/h1-8,10H,9H2,(H,19,20) |
| InChIKey | SDLAFGJSJKQCBA-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.27 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|