C16H15Cl3F3N3O2S — CID 22207721
2,4,5-trichloro-N-[3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]benzenesulfonamide (PubChem CID 22207721) has the molecular formula C16H15Cl3F3N3O2S and a molecular weight of 476.74 g/mol. Its IUPAC name is 2,4,5-trichloro-N-[3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]benzenesulfonamide.
| Compound Name | 2,4,5-trichloro-N-[3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 22207721 |
| Molecular Formula | C16H15Cl3F3N3O2S |
| Molecular Weight | 476.74 g/mol |
| Exact Mass | 474.99 |
| IUPAC Name | 2,4,5-trichloro-N-[3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCCn1nc(C(F)(F)F)cc1C1CC1)c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C16H15Cl3F3N3O2S/c17-10-6-12(19)14(7-11(10)18)28(26,27)23-4-1-5-25-13(9-2-3-9)8-15(24-25)16(20,21)22/h6-9,23H,1-5H2 |
| InChIKey | FWVAYJAPQKELMV-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.74 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|