About 4-[4-[(1-ethyl-5-methylpyrazol-4-yl)methyl]piperazin-1-yl]sulfonyl-2,1,3-benzoxadiazole
4-[4-[(1-ethyl-5-methylpyrazol-4-yl)methyl]piperazin-1-yl]sulfonyl-2,1,3-benzoxadiazole (PubChem CID 22208364) has the molecular formula C17H22N6O3S
and a molecular weight of 390.47 g/mol. Its IUPAC name is 4-[4-[(1-ethyl-5-methylpyrazol-4-yl)methyl]piperazin-1-yl]sulfonyl-2,1,3-benzoxadiazole.
Molecular Properties
| Compound Name | 4-[4-[(1-ethyl-5-methylpyrazol-4-yl)methyl]piperazin-1-yl]sulfonyl-2,1,3-benzoxadiazole |
| PubChem CID | 22208364 |
| Molecular Formula | C17H22N6O3S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 4-[4-[(1-ethyl-5-methylpyrazol-4-yl)methyl]piperazin-1-yl]sulfonyl-2,1,3-benzoxadiazole |
| SMILES | CCn1ncc(CN2CCN(S(=O)(=O)c3cccc4nonc34)CC2)c1C |
| InChI | InChI=1S/C17H22N6O3S/c1-3-23-13(2)14(11-18-23)12-21-7-9-22(10-8-21)27(24,25)16-6-4-5-15-17(16)20-26-19-15/h4-6,11H,3,7-10,12H2,1-2H3 |
| InChIKey | MDNIPEXNAZKTKX-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 4-[4-[(1-ethyl-5-methylpyrazol-4-yl)methyl]piperazin-1-yl]sulfonyl-2,1,3-benzoxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[(1-ethyl-5-methylpyrazol-4-yl)methyl]piperazin-1-yl]sulfonyl-2,1,3-benzoxadiazole?
The IUPAC name of 4-[4-[(1-ethyl-5-methylpyrazol-4-yl)methyl]piperazin-1-yl]sulfonyl-2,1,3-benzoxadiazole (CID 22208364) is 4-[4-[(1-ethyl-5-methylpyrazol-4-yl)methyl]piperazin-1-yl]sulfonyl-2,1,3-benzoxadiazole.
What is the SMILES notation for 4-[4-[(1-ethyl-5-methylpyrazol-4-yl)methyl]piperazin-1-yl]sulfonyl-2,1,3-benzoxadiazole?
The canonical SMILES for 4-[4-[(1-ethyl-5-methylpyrazol-4-yl)methyl]piperazin-1-yl]sulfonyl-2,1,3-benzoxadiazole is CCn1ncc(CN2CCN(S(=O)(=O)c3cccc4nonc34)CC2)c1C.
What is the InChIKey of 4-[4-[(1-ethyl-5-methylpyrazol-4-yl)methyl]piperazin-1-yl]sulfonyl-2,1,3-benzoxadiazole?
The InChIKey is MDNIPEXNAZKTKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N6O3S/c1-3-23-13(2)14(11-18-23)12-21-7-9-22(10-8-21)27(24,25)16-6-4-5-15-17(16)20-26-19-15/h4-6,11H,3,7-10,12H2,1-2H3.
What are the key properties of 4-[4-[(1-ethyl-5-methylpyrazol-4-yl)methyl]piperazin-1-yl]sulfonyl-2,1,3-benzoxadiazole?
4-[4-[(1-ethyl-5-methylpyrazol-4-yl)methyl]piperazin-1-yl]sulfonyl-2,1,3-benzoxadiazole has a molecular weight of 390.47 g/mol, XLogP of 1.25, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[(1-ethyl-5-methylpyrazol-4-yl)methyl]piperazin-1-yl]sulfonyl-2,1,3-benzoxadiazole is sourced from PubChem (CID 22208364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).