C14H26N4O5 — CID 22210776
3-acetamido-4-(diaminomethylamino)-2-(1-ethoxypropyl)-3,4-dihydro-2H-pyran-6-carboxylic acid (PubChem CID 22210776) has the molecular formula C14H26N4O5 and a molecular weight of 330.39 g/mol. Its IUPAC name is 3-acetamido-4-(diaminomethylamino)-2-(1-ethoxypropyl)-3,4-dihydro-2H-pyran-6-carboxylic acid.
| Compound Name | 3-acetamido-4-(diaminomethylamino)-2-(1-ethoxypropyl)-3,4-dihydro-2H-pyran-6-carboxylic acid |
|---|---|
| PubChem CID | 22210776 |
| Molecular Formula | C14H26N4O5 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 3-acetamido-4-(diaminomethylamino)-2-(1-ethoxypropyl)-3,4-dihydro-2H-pyran-6-carboxylic acid |
| SMILES | CCOC(CC)C1OC(C(=O)O)=CC(NC(N)N)C1NC(C)=O |
| InChI | InChI=1S/C14H26N4O5/c1-4-9(22-5-2)12-11(17-7(3)19)8(18-14(15)16)6-10(23-12)13(20)21/h6,8-9,11-12,14,18H,4-5,15-16H2,1-3H3,(H,17,19)(H,20,21) |
| InChIKey | JANPACLFLDFRPT-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 148.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|