C6H9NO3S — CID 22212934
3,5-dioxo-N-sulfanylhexanamide (PubChem CID 22212934) has the molecular formula C6H9NO3S and a molecular weight of 175.21 g/mol. Its IUPAC name is 3,5-dioxo-N-sulfanylhexanamide.
| Compound Name | 3,5-dioxo-N-sulfanylhexanamide |
|---|---|
| PubChem CID | 22212934 |
| Molecular Formula | C6H9NO3S |
| Molecular Weight | 175.21 g/mol |
| Exact Mass | 175.03 |
| IUPAC Name | 3,5-dioxo-N-sulfanylhexanamide |
| SMILES | CC(=O)CC(=O)CC(=O)NS |
| InChI | InChI=1S/C6H9NO3S/c1-4(8)2-5(9)3-6(10)7-11/h11H,2-3H2,1H3,(H,7,10) |
| InChIKey | OJPYCEPIACTSEE-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.21 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|