About 3,5-dioxohexanoyl chloride
3,5-dioxohexanoyl chloride (PubChem CID 130027067) has the molecular formula C6H7ClO3
and a molecular weight of 162.57 g/mol. Its IUPAC name is 3,5-dioxohexanoyl chloride.
Molecular Properties
| Compound Name | 3,5-dioxohexanoyl chloride |
| PubChem CID | 130027067 |
| Molecular Formula | C6H7ClO3 |
| Molecular Weight | 162.57 g/mol |
| Exact Mass | 162.01 |
| IUPAC Name | 3,5-dioxohexanoyl chloride |
| SMILES | CC(=O)CC(=O)CC(=O)Cl |
| InChI | InChI=1S/C6H7ClO3/c1-4(8)2-5(9)3-6(7)10/h2-3H2,1H3 |
| InChIKey | LSNGIEITHBUXIE-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.57 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dioxohexanoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dioxohexanoyl chloride?
The IUPAC name of 3,5-dioxohexanoyl chloride (CID 130027067) is 3,5-dioxohexanoyl chloride.
What is the SMILES notation for 3,5-dioxohexanoyl chloride?
The canonical SMILES for 3,5-dioxohexanoyl chloride is CC(=O)CC(=O)CC(=O)Cl.
What is the InChIKey of 3,5-dioxohexanoyl chloride?
The InChIKey is LSNGIEITHBUXIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7ClO3/c1-4(8)2-5(9)3-6(7)10/h2-3H2,1H3.
What are the key properties of 3,5-dioxohexanoyl chloride?
3,5-dioxohexanoyl chloride has a molecular weight of 162.57 g/mol, XLogP of 0.69, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dioxohexanoyl chloride is sourced from PubChem (CID 130027067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).