C14H15I2NO3S — CID 22214551
(1S,3S,4S,5S,7S,8S)-6-(benzenesulfonyl)-4,8-diiodo-2-oxa-6-azatricyclo[3.3.1.13,7]decane (PubChem CID 22214551) has the molecular formula C14H15I2NO3S and a molecular weight of 531.15 g/mol. Its IUPAC name is (1S,3S,4S,5S,7S,8S)-6-(benzenesulfonyl)-4,8-diiodo-2-oxa-6-azatricyclo[3.3.1.13,7]decane.
| Compound Name | (1S,3S,4S,5S,7S,8S)-6-(benzenesulfonyl)-4,8-diiodo-2-oxa-6-azatricyclo[3.3.1.13,7]decane |
|---|---|
| PubChem CID | 22214551 |
| Molecular Formula | C14H15I2NO3S |
| Molecular Weight | 531.15 g/mol |
| Exact Mass | 530.89 |
| IUPAC Name | (1S,3S,4S,5S,7S,8S)-6-(benzenesulfonyl)-4,8-diiodo-2-oxa-6-azatricyclo[3.3.1.13,7]decane |
| SMILES | O=S(=O)(c1ccccc1)N1[C@H]2C[C@@H]3O[C@@H](C[C@H]1[C@@H]3I)[C@H]2I |
| InChI | InChI=1S/C14H15I2NO3S/c15-13-9-6-11-14(16)10(7-12(13)20-11)17(9)21(18,19)8-4-2-1-3-5-8/h1-5,9-14H,6-7H2/t9-,10-,11-,12-,13-,14-/m0/s1 |
| InChIKey | QSEWEHPACNWDGD-LHEWDLALSA-N |
| XLogP | 2.60 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.15 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|