C10H9F6NO3 — CID 22214554
[(1S,4R)-4-[(2,2,2-trifluoroacetyl)amino]cyclohex-2-en-1-yl] 2,2,2-trifluoroacetate (PubChem CID 22214554) has the molecular formula C10H9F6NO3 and a molecular weight of 305.17 g/mol. Its IUPAC name is [(1S,4R)-4-[(2,2,2-trifluoroacetyl)amino]cyclohex-2-en-1-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(1S,4R)-4-[(2,2,2-trifluoroacetyl)amino]cyclohex-2-en-1-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 22214554 |
| Molecular Formula | C10H9F6NO3 |
| Molecular Weight | 305.17 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | [(1S,4R)-4-[(2,2,2-trifluoroacetyl)amino]cyclohex-2-en-1-yl] 2,2,2-trifluoroacetate |
| SMILES | O=C(N[C@H]1C=C[C@@H](OC(=O)C(F)(F)F)CC1)C(F)(F)F |
| InChI | InChI=1S/C10H9F6NO3/c11-9(12,13)7(18)17-5-1-3-6(4-2-5)20-8(19)10(14,15)16/h1,3,5-6H,2,4H2,(H,17,18)/t5-,6+/m0/s1 |
| InChIKey | YWQJFNGCPFMAAL-NTSWFWBYSA-N |
| XLogP | 1.86 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.17 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|