C10H15NO4 — CID 163878824
[(1R,4S)-4-(methoxycarbonylamino)cyclohex-2-en-1-yl] acetate (PubChem CID 163878824) has the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. Its IUPAC name is [(1R,4S)-4-(methoxycarbonylamino)cyclohex-2-en-1-yl] acetate.
| Compound Name | [(1R,4S)-4-(methoxycarbonylamino)cyclohex-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 163878824 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | [(1R,4S)-4-(methoxycarbonylamino)cyclohex-2-en-1-yl] acetate |
| SMILES | COC(=O)N[C@@H]1C=C[C@H](OC(C)=O)CC1 |
| InChI | InChI=1S/C10H15NO4/c1-7(12)15-9-5-3-8(4-6-9)11-10(13)14-2/h3,5,8-9H,4,6H2,1-2H3,(H,11,13)/t8-,9+/m1/s1 |
| InChIKey | PRHWEMDAVZNBDF-BDAKNGLRSA-N |
| XLogP | 0.99 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|