C14H19NO7 — CID 12662382
[(1S,4S,5S,6R)-4-acetamido-5,6-diacetyloxycyclohex-2-en-1-yl] acetate (PubChem CID 12662382) has the molecular formula C14H19NO7 and a molecular weight of 313.31 g/mol. Its IUPAC name is [(1S,4S,5S,6R)-4-acetamido-5,6-diacetyloxycyclohex-2-en-1-yl] acetate.
| Compound Name | [(1S,4S,5S,6R)-4-acetamido-5,6-diacetyloxycyclohex-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 12662382 |
| Molecular Formula | C14H19NO7 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | [(1S,4S,5S,6R)-4-acetamido-5,6-diacetyloxycyclohex-2-en-1-yl] acetate |
| SMILES | CC(=O)N[C@H]1C=C[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C14H19NO7/c1-7(16)15-11-5-6-12(20-8(2)17)14(22-10(4)19)13(11)21-9(3)18/h5-6,11-14H,1-4H3,(H,15,16)/t11-,12-,13-,14+/m0/s1 |
| InChIKey | CYPUXKRIWFICCK-XDQVBPFNSA-N |
| XLogP | -0.14 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|