C15H23NO6 — CID 139039418
[(1S,5R,6R)-6-acetyloxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohex-2-en-1-yl] acetate (PubChem CID 139039418) has the molecular formula C15H23NO6 and a molecular weight of 313.35 g/mol. Its IUPAC name is [(1S,5R,6R)-6-acetyloxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohex-2-en-1-yl] acetate.
| Compound Name | [(1S,5R,6R)-6-acetyloxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohex-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 139039418 |
| Molecular Formula | C15H23NO6 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | [(1S,5R,6R)-6-acetyloxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohex-2-en-1-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H](OC(C)=O)C=CC[C@H]1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H23NO6/c1-9(17)20-12-8-6-7-11(13(12)21-10(2)18)16-14(19)22-15(3,4)5/h6,8,11-13H,7H2,1-5H3,(H,16,19)/t11-,12+,13-/m1/s1 |
| InChIKey | WSCGVBVJXQAYCZ-FRRDWIJNSA-N |
| XLogP | 1.70 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|