C17H23NO9 — CID 135012310
[(3S,4S,5S,6S)-3-acetamido-4,5,6-triacetyloxycyclohexen-1-yl]methyl acetate (PubChem CID 135012310) has the molecular formula C17H23NO9 and a molecular weight of 385.37 g/mol. Its IUPAC name is [(3S,4S,5S,6S)-3-acetamido-4,5,6-triacetyloxycyclohexen-1-yl]methyl acetate.
| Compound Name | [(3S,4S,5S,6S)-3-acetamido-4,5,6-triacetyloxycyclohexen-1-yl]methyl acetate |
|---|---|
| PubChem CID | 135012310 |
| Molecular Formula | C17H23NO9 |
| Molecular Weight | 385.37 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | [(3S,4S,5S,6S)-3-acetamido-4,5,6-triacetyloxycyclohexen-1-yl]methyl acetate |
| SMILES | CC(=O)N[C@H]1C=C(COC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C17H23NO9/c1-8(19)18-14-6-13(7-24-9(2)20)15(25-10(3)21)17(27-12(5)23)16(14)26-11(4)22/h6,14-17H,7H2,1-5H3,(H,18,19)/t14-,15-,16-,17-/m0/s1 |
| InChIKey | BGWUDGFQBITPFE-QAETUUGQSA-N |
| XLogP | -0.21 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.37 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|