C10H12F3NO3 — CID 538569
[4-[(2,2,2-trifluoroacetyl)amino]cyclohex-2-en-1-yl] acetate (PubChem CID 538569) has the molecular formula C10H12F3NO3 and a molecular weight of 251.20 g/mol. Its IUPAC name is [4-[(2,2,2-trifluoroacetyl)amino]cyclohex-2-en-1-yl] acetate.
| Compound Name | [4-[(2,2,2-trifluoroacetyl)amino]cyclohex-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 538569 |
| Molecular Formula | C10H12F3NO3 |
| Molecular Weight | 251.20 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | [4-[(2,2,2-trifluoroacetyl)amino]cyclohex-2-en-1-yl] acetate |
| SMILES | CC(=O)OC1C=CC(NC(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C10H12F3NO3/c1-6(15)17-8-4-2-7(3-5-8)14-9(16)10(11,12)13/h2,4,7-8H,3,5H2,1H3,(H,14,16) |
| InChIKey | BPANAIYVIYIISG-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.20 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|