C12H19NO5 — CID 101163825
[(1R,4S)-4-(ethoxycarbonylamino)cyclohex-2-en-1-yl] ethyl carbonate (PubChem CID 101163825) has the molecular formula C12H19NO5 and a molecular weight of 257.29 g/mol. Its IUPAC name is [(1R,4S)-4-(ethoxycarbonylamino)cyclohex-2-en-1-yl] ethyl carbonate.
| Compound Name | [(1R,4S)-4-(ethoxycarbonylamino)cyclohex-2-en-1-yl] ethyl carbonate |
|---|---|
| PubChem CID | 101163825 |
| Molecular Formula | C12H19NO5 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | [(1R,4S)-4-(ethoxycarbonylamino)cyclohex-2-en-1-yl] ethyl carbonate |
| SMILES | CCOC(=O)N[C@@H]1C=C[C@H](OC(=O)OCC)CC1 |
| InChI | InChI=1S/C12H19NO5/c1-3-16-11(14)13-9-5-7-10(8-6-9)18-12(15)17-4-2/h5,7,9-10H,3-4,6,8H2,1-2H3,(H,13,14)/t9-,10+/m1/s1 |
| InChIKey | PVVJSBYHBLJNPL-ZJUUUORDSA-N |
| XLogP | 1.99 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|