C19H27ClN2 — CID 22215460
1-N-(6-chloronaphthalen-1-yl)-4-N,4-N-diethylpentane-1,4-diamine (PubChem CID 22215460) has the molecular formula C19H27ClN2 and a molecular weight of 318.89 g/mol. Its IUPAC name is 1-N-(6-chloronaphthalen-1-yl)-4-N,4-N-diethylpentane-1,4-diamine.
| Compound Name | 1-N-(6-chloronaphthalen-1-yl)-4-N,4-N-diethylpentane-1,4-diamine |
|---|---|
| PubChem CID | 22215460 |
| Molecular Formula | C19H27ClN2 |
| Molecular Weight | 318.89 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 1-N-(6-chloronaphthalen-1-yl)-4-N,4-N-diethylpentane-1,4-diamine |
| SMILES | CCN(CC)C(C)CCCNc1cccc2cc(Cl)ccc12 |
| InChI | InChI=1S/C19H27ClN2/c1-4-22(5-2)15(3)8-7-13-21-19-10-6-9-16-14-17(20)11-12-18(16)19/h6,9-12,14-15,21H,4-5,7-8,13H2,1-3H3 |
| InChIKey | WWYOFEHFZUQIMD-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.89 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|