C20H24N2 — CID 22216588
(1S,9S,10R,12S,19S)-10,20-dimethyl-8,16-diazahexacyclo[10.6.1.19,12.01,9.02,7.016,19]icosa-2,4,6,13-tetraene (PubChem CID 22216588) has the molecular formula C20H24N2 and a molecular weight of 292.43 g/mol. Its IUPAC name is (1S,9S,10R,12S,19S)-10,20-dimethyl-8,16-diazahexacyclo[10.6.1.19,12.01,9.02,7.016,19]icosa-2,4,6,13-tetraene.
| Compound Name | (1S,9S,10R,12S,19S)-10,20-dimethyl-8,16-diazahexacyclo[10.6.1.19,12.01,9.02,7.016,19]icosa-2,4,6,13-tetraene |
|---|---|
| PubChem CID | 22216588 |
| Molecular Formula | C20H24N2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | (1S,9S,10R,12S,19S)-10,20-dimethyl-8,16-diazahexacyclo[10.6.1.19,12.01,9.02,7.016,19]icosa-2,4,6,13-tetraene |
| SMILES | CC1[C@]23Nc4ccccc4[C@]24CCN2CC=C[C@]1(C[C@H]3C)[C@H]24 |
| InChI | InChI=1S/C20H24N2/c1-13-12-18-8-5-10-22-11-9-19(17(18)22)15-6-3-4-7-16(15)21-20(13,19)14(18)2/h3-8,13-14,17,21H,9-12H2,1-2H3/t13-,14?,17+,18-,19+,20+/m1/s1 |
| InChIKey | PGRRVTBJSZWIAR-YIKMABNTSA-N |
| XLogP | 3.41 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|