C24H30N2O2 — CID 607874
(8-ethyl-20-methyl-8,16-diazahexacyclo[10.6.1.19,12.01,9.02,7.016,19]icosa-2,4,6,13-tetraen-10-yl)methyl acetate (PubChem CID 607874) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is (8-ethyl-20-methyl-8,16-diazahexacyclo[10.6.1.19,12.01,9.02,7.016,19]icosa-2,4,6,13-tetraen-10-yl)methyl acetate.
| Compound Name | (8-ethyl-20-methyl-8,16-diazahexacyclo[10.6.1.19,12.01,9.02,7.016,19]icosa-2,4,6,13-tetraen-10-yl)methyl acetate |
|---|---|
| PubChem CID | 607874 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | (8-ethyl-20-methyl-8,16-diazahexacyclo[10.6.1.19,12.01,9.02,7.016,19]icosa-2,4,6,13-tetraen-10-yl)methyl acetate |
| SMILES | CCN1c2ccccc2C23CCN4CC=CC5(CC(COC(C)=O)C12C5C)C43 |
| InChI | InChI=1S/C24H30N2O2/c1-4-26-20-9-6-5-8-19(20)23-11-13-25-12-7-10-22(21(23)25)14-18(15-28-17(3)27)24(23,26)16(22)2/h5-10,16,18,21H,4,11-15H2,1-3H3 |
| InChIKey | SSECSYZNGMWCLE-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|