C21H28N2O — CID 6572761
1-[(1R,9S,10S,11S,12R,17S)-12-ethyl-10-methyl-8,14-diazapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6-trien-8-yl]ethanone (PubChem CID 6572761) has the molecular formula C21H28N2O and a molecular weight of 324.47 g/mol. Its IUPAC name is 1-[(1R,9S,10S,11S,12R,17S)-12-ethyl-10-methyl-8,14-diazapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6-trien-8-yl]ethanone.
| Compound Name | 1-[(1R,9S,10S,11S,12R,17S)-12-ethyl-10-methyl-8,14-diazapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6-trien-8-yl]ethanone |
|---|---|
| PubChem CID | 6572761 |
| Molecular Formula | C21H28N2O |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | 1-[(1R,9S,10S,11S,12R,17S)-12-ethyl-10-methyl-8,14-diazapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6-trien-8-yl]ethanone |
| SMILES | CC[C@H]1CN2CC[C@]34c5ccccc5N(C(C)=O)[C@H]3[C@@H](C)[C@H]1C[C@H]24 |
| InChI | InChI=1S/C21H28N2O/c1-4-15-12-22-10-9-21-17-7-5-6-8-18(17)23(14(3)24)20(21)13(2)16(15)11-19(21)22/h5-8,13,15-16,19-20H,4,9-12H2,1-3H3/t13-,15-,16+,19-,20-,21+/m0/s1 |
| InChIKey | XGMPQFYSSHFZTA-WNCSZWILSA-N |
| XLogP | 3.43 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |