C20H24N2O3 — CID 12868133
1-(3-acetyl-18-hydroxy-3,13-diazapentacyclo[12.3.1.02,10.04,9.010,15]octadeca-4,6,8-trien-13-yl)ethanone (PubChem CID 12868133) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is 1-(3-acetyl-18-hydroxy-3,13-diazapentacyclo[12.3.1.02,10.04,9.010,15]octadeca-4,6,8-trien-13-yl)ethanone.
| Compound Name | 1-(3-acetyl-18-hydroxy-3,13-diazapentacyclo[12.3.1.02,10.04,9.010,15]octadeca-4,6,8-trien-13-yl)ethanone |
|---|---|
| PubChem CID | 12868133 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 1-(3-acetyl-18-hydroxy-3,13-diazapentacyclo[12.3.1.02,10.04,9.010,15]octadeca-4,6,8-trien-13-yl)ethanone |
| SMILES | CC(=O)N1CCC23c4ccccc4N(C(C)=O)C2C2CCC3C1C2O |
| InChI | InChI=1S/C20H24N2O3/c1-11(23)21-10-9-20-14-5-3-4-6-16(14)22(12(2)24)19(20)13-7-8-15(20)17(21)18(13)25/h3-6,13,15,17-19,25H,7-10H2,1-2H3 |
| InChIKey | NAJFRRJWEPSTCK-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |