C19H23ClN2O — CID 22216751
(2-chloroquinolin-4-yl)-[(2R,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]methanol (PubChem CID 22216751) has the molecular formula C19H23ClN2O and a molecular weight of 330.86 g/mol. Its IUPAC name is (2-chloroquinolin-4-yl)-[(2R,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]methanol.
| Compound Name | (2-chloroquinolin-4-yl)-[(2R,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]methanol |
|---|---|
| PubChem CID | 22216751 |
| Molecular Formula | C19H23ClN2O |
| Molecular Weight | 330.86 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | (2-chloroquinolin-4-yl)-[(2R,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]methanol |
| SMILES | CC[C@H]1CN2CC[C@H]1C[C@@H]2C(O)c1cc(Cl)nc2ccccc12 |
| InChI | InChI=1S/C19H23ClN2O/c1-2-12-11-22-8-7-13(12)9-17(22)19(23)15-10-18(20)21-16-6-4-3-5-14(15)16/h3-6,10,12-13,17,19,23H,2,7-9,11H2,1H3/t12-,13-,17+,19?/m0/s1 |
| InChIKey | IPLNQKPFYUEOAP-GSVGAVSLSA-N |
| XLogP | 4.04 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.86 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|