C16H21N3 — CID 22219583
1-benzyl-4-(1,2-dihydropyridin-2-yl)piperazine (PubChem CID 22219583) has the molecular formula C16H21N3 and a molecular weight of 255.37 g/mol. Its IUPAC name is 1-benzyl-4-(1,2-dihydropyridin-2-yl)piperazine.
| Compound Name | 1-benzyl-4-(1,2-dihydropyridin-2-yl)piperazine |
|---|---|
| PubChem CID | 22219583 |
| Molecular Formula | C16H21N3 |
| Molecular Weight | 255.37 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | 1-benzyl-4-(1,2-dihydropyridin-2-yl)piperazine |
| SMILES | C1=CNC(N2CCN(Cc3ccccc3)CC2)C=C1 |
| InChI | InChI=1S/C16H21N3/c1-2-6-15(7-3-1)14-18-10-12-19(13-11-18)16-8-4-5-9-17-16/h1-9,16-17H,10-14H2 |
| InChIKey | SSWRONNXBWAZLH-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.37 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |