C17H22NO3- — CID 2222028
cis-(1S,2R)-2-[(4-ethylphenyl)methylcarbamoyl]cyclohexane-1-carboxylate (PubChem CID 2222028) has the molecular formula C17H22NO3- and a molecular weight of 288.37 g/mol. Its IUPAC name is cis-(1S,2R)-2-[(4-ethylphenyl)methylcarbamoyl]cyclohexane-1-carboxylate.
| Compound Name | cis-(1S,2R)-2-[(4-ethylphenyl)methylcarbamoyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 2222028 |
| Molecular Formula | C17H22NO3- |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | cis-(1S,2R)-2-[(4-ethylphenyl)methylcarbamoyl]cyclohexane-1-carboxylate |
| SMILES | CCc1ccc(CNC(=O)[C@@H]2CCCC[C@@H]2C(=O)[O-])cc1 |
| InChI | InChI=1S/C17H23NO3/c1-2-12-7-9-13(10-8-12)11-18-16(19)14-5-3-4-6-15(14)17(20)21/h7-10,14-15H,2-6,11H2,1H3,(H,18,19)(H,20,21)/p-1/t14-,15+/m1/s1 |
| InChIKey | ORQKMANGLIADRO-CABCVRRESA-M |
| XLogP | 1.42 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |