C26H27N5O5 — CID 22225133
N-(3,4-dimethoxyphenyl)-4-[2-(2-methoxyethylamino)-4-methyl-7-oxopyrido[2,3-d]pyrimidin-8-yl]benzamide (PubChem CID 22225133) has the molecular formula C26H27N5O5 and a molecular weight of 489.53 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-4-[2-(2-methoxyethylamino)-4-methyl-7-oxopyrido[2,3-d]pyrimidin-8-yl]benzamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-4-[2-(2-methoxyethylamino)-4-methyl-7-oxopyrido[2,3-d]pyrimidin-8-yl]benzamide |
|---|---|
| PubChem CID | 22225133 |
| Molecular Formula | C26H27N5O5 |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-4-[2-(2-methoxyethylamino)-4-methyl-7-oxopyrido[2,3-d]pyrimidin-8-yl]benzamide |
| SMILES | COCCNc1nc(C)c2ccc(=O)n(-c3ccc(C(=O)Nc4ccc(OC)c(OC)c4)cc3)c2n1 |
| InChI | InChI=1S/C26H27N5O5/c1-16-20-10-12-23(32)31(24(20)30-26(28-16)27-13-14-34-2)19-8-5-17(6-9-19)25(33)29-18-7-11-21(35-3)22(15-18)36-4/h5-12,15H,13-14H2,1-4H3,(H,29,33)(H,27,28,30) |
| InChIKey | ZYFQKMAEPLTJPG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 116.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|