C22H29N7O3 — CID 22225165
3-[[4-[2-(2-aminoethylamino)-4-methyl-7-oxopyrido[2,3-d]pyrimidin-8-yl]benzoyl]amino]-N,N-dimethylpropan-1-amine oxide (PubChem CID 22225165) has the molecular formula C22H29N7O3 and a molecular weight of 439.52 g/mol. Its IUPAC name is 3-[[4-[2-(2-aminoethylamino)-4-methyl-7-oxopyrido[2,3-d]pyrimidin-8-yl]benzoyl]amino]-N,N-dimethylpropan-1-amine oxide.
| Compound Name | 3-[[4-[2-(2-aminoethylamino)-4-methyl-7-oxopyrido[2,3-d]pyrimidin-8-yl]benzoyl]amino]-N,N-dimethylpropan-1-amine oxide |
|---|---|
| PubChem CID | 22225165 |
| Molecular Formula | C22H29N7O3 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | 3-[[4-[2-(2-aminoethylamino)-4-methyl-7-oxopyrido[2,3-d]pyrimidin-8-yl]benzoyl]amino]-N,N-dimethylpropan-1-amine oxide |
| SMILES | Cc1nc(NCCN)nc2c1ccc(=O)n2-c1ccc(C(=O)NCCC[N+](C)(C)[O-])cc1 |
| InChI | InChI=1S/C22H29N7O3/c1-15-18-9-10-19(30)28(20(18)27-22(26-15)25-13-11-23)17-7-5-16(6-8-17)21(31)24-12-4-14-29(2,3)32/h5-10H,4,11-14,23H2,1-3H3,(H,24,31)(H,25,26,27) |
| InChIKey | GEBLDIHHLTYWLN-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 137.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|