C11H10N2O2S — CID 22229291
3-(3,4-dimethylphenyl)-1,2,4-thiadiazole-5-carboxylic acid (PubChem CID 22229291) has the molecular formula C11H10N2O2S and a molecular weight of 234.28 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)-1,2,4-thiadiazole-5-carboxylic acid.
| Compound Name | 3-(3,4-dimethylphenyl)-1,2,4-thiadiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 22229291 |
| Molecular Formula | C11H10N2O2S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 3-(3,4-dimethylphenyl)-1,2,4-thiadiazole-5-carboxylic acid |
| SMILES | Cc1ccc(-c2nsc(C(=O)O)n2)cc1C |
| InChI | InChI=1S/C11H10N2O2S/c1-6-3-4-8(5-7(6)2)9-12-10(11(14)15)16-13-9/h3-5H,1-2H3,(H,14,15) |
| InChIKey | ZKDXGTJQLZXSEE-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |