C15H29NOSi — CID 22236378
2-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohexyl]acetonitrile (PubChem CID 22236378) has the molecular formula C15H29NOSi and a molecular weight of 267.49 g/mol. Its IUPAC name is 2-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohexyl]acetonitrile.
| Compound Name | 2-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohexyl]acetonitrile |
|---|---|
| PubChem CID | 22236378 |
| Molecular Formula | C15H29NOSi |
| Molecular Weight | 267.49 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | 2-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohexyl]acetonitrile |
| SMILES | CC(C)(C)[Si](C)(C)OCC1CCC(CC#N)CC1 |
| InChI | InChI=1S/C15H29NOSi/c1-15(2,3)18(4,5)17-12-14-8-6-13(7-9-14)10-11-16/h13-14H,6-10,12H2,1-5H3 |
| InChIKey | CIECDVVEXQTHER-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.49 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|