C19H36N2O3Si — CID 90773951
tert-butyl N-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-cyanocyclohexyl]carbamate (PubChem CID 90773951) has the molecular formula C19H36N2O3Si and a molecular weight of 368.59 g/mol. Its IUPAC name is tert-butyl N-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-cyanocyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-cyanocyclohexyl]carbamate |
|---|---|
| PubChem CID | 90773951 |
| Molecular Formula | C19H36N2O3Si |
| Molecular Weight | 368.59 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | tert-butyl N-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-cyanocyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(C#N)CCC(CO[Si](C)(C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C19H36N2O3Si/c1-17(2,3)24-16(22)21-19(14-20)11-9-15(10-12-19)13-23-25(7,8)18(4,5)6/h15H,9-13H2,1-8H3,(H,21,22) |
| InChIKey | KYKKHJSTGOPFDY-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.59 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|