C16H34N2O4Si — CID 173031086
4-[[tert-butyl(dimethyl)silyl]oxymethyl]-N'-(2,2-dihydroxyethoxy)cyclohexane-1-carboximidamide (PubChem CID 173031086) has the molecular formula C16H34N2O4Si and a molecular weight of 346.54 g/mol. Its IUPAC name is 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-N'-(2,2-dihydroxyethoxy)cyclohexane-1-carboximidamide.
| Compound Name | 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-N'-(2,2-dihydroxyethoxy)cyclohexane-1-carboximidamide |
|---|---|
| PubChem CID | 173031086 |
| Molecular Formula | C16H34N2O4Si |
| Molecular Weight | 346.54 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-N'-(2,2-dihydroxyethoxy)cyclohexane-1-carboximidamide |
| SMILES | CC(C)(C)[Si](C)(C)OCC1CCC(C(N)=NOCC(O)O)CC1 |
| InChI | InChI=1S/C16H34N2O4Si/c1-16(2,3)23(4,5)22-10-12-6-8-13(9-7-12)15(17)18-21-11-14(19)20/h12-14,19-20H,6-11H2,1-5H3,(H2,17,18) |
| InChIKey | LJPMHGJMZRAHNT-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.54 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|