C10H8N2OS — CID 2223769
3-(2-sulfanylidene-1,3-benzoxazol-3-yl)propanenitrile (PubChem CID 2223769) has the molecular formula C10H8N2OS and a molecular weight of 204.25 g/mol. Its IUPAC name is 3-(2-sulfanylidene-1,3-benzoxazol-3-yl)propanenitrile.
| Compound Name | 3-(2-sulfanylidene-1,3-benzoxazol-3-yl)propanenitrile |
|---|---|
| PubChem CID | 2223769 |
| Molecular Formula | C10H8N2OS |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.04 |
| IUPAC Name | 3-(2-sulfanylidene-1,3-benzoxazol-3-yl)propanenitrile |
| SMILES | N#CCCn1c(=S)oc2ccccc21 |
| InChI | InChI=1S/C10H8N2OS/c11-6-3-7-12-8-4-1-2-5-9(8)13-10(12)14/h1-2,4-5H,3,7H2 |
| InChIKey | OYWAZTQTBZTSAC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 41.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|