About 3-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,3-benzoxazole-2-thione
3-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,3-benzoxazole-2-thione (PubChem CID 2403182) has the molecular formula C16H17N5OS
and a molecular weight of 327.41 g/mol. Its IUPAC name is 3-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,3-benzoxazole-2-thione.
Molecular Properties
| Compound Name | 3-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,3-benzoxazole-2-thione |
| PubChem CID | 2403182 |
| Molecular Formula | C16H17N5OS |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 3-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,3-benzoxazole-2-thione |
| SMILES | S=c1oc2ccccc2n1CN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C16H17N5OS/c23-16-21(13-4-1-2-5-14(13)22-16)12-19-8-10-20(11-9-19)15-17-6-3-7-18-15/h1-7H,8-12H2 |
| InChIKey | CJDDTVWXBSXICQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 50.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,3-benzoxazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,3-benzoxazole-2-thione?
The IUPAC name of 3-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,3-benzoxazole-2-thione (CID 2403182) is 3-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,3-benzoxazole-2-thione.
What is the SMILES notation for 3-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,3-benzoxazole-2-thione?
The canonical SMILES for 3-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,3-benzoxazole-2-thione is S=c1oc2ccccc2n1CN1CCN(c2ncccn2)CC1.
What is the InChIKey of 3-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,3-benzoxazole-2-thione?
The InChIKey is CJDDTVWXBSXICQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N5OS/c23-16-21(13-4-1-2-5-14(13)22-16)12-19-8-10-20(11-9-19)15-17-6-3-7-18-15/h1-7H,8-12H2.
What are the key properties of 3-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,3-benzoxazole-2-thione?
3-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,3-benzoxazole-2-thione has a molecular weight of 327.41 g/mol, XLogP of 2.53, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,3-benzoxazole-2-thione is sourced from PubChem (CID 2403182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).