C22H19Cl2N5O2S — CID 26504074
4-chloro-5-[4-[(6-chloro-2-sulfanylidene-1,3-benzoxazol-3-yl)methyl]piperazin-1-yl]-2-phenylpyridazin-3-one (PubChem CID 26504074) has the molecular formula C22H19Cl2N5O2S and a molecular weight of 488.40 g/mol. Its IUPAC name is 4-chloro-5-[4-[(6-chloro-2-sulfanylidene-1,3-benzoxazol-3-yl)methyl]piperazin-1-yl]-2-phenylpyridazin-3-one.
| Compound Name | 4-chloro-5-[4-[(6-chloro-2-sulfanylidene-1,3-benzoxazol-3-yl)methyl]piperazin-1-yl]-2-phenylpyridazin-3-one |
|---|---|
| PubChem CID | 26504074 |
| Molecular Formula | C22H19Cl2N5O2S |
| Molecular Weight | 488.40 g/mol |
| Exact Mass | 487.06 |
| IUPAC Name | 4-chloro-5-[4-[(6-chloro-2-sulfanylidene-1,3-benzoxazol-3-yl)methyl]piperazin-1-yl]-2-phenylpyridazin-3-one |
| SMILES | O=c1c(Cl)c(N2CCN(Cn3c(=S)oc4cc(Cl)ccc43)CC2)cnn1-c1ccccc1 |
| InChI | InChI=1S/C22H19Cl2N5O2S/c23-15-6-7-17-19(12-15)31-22(32)28(17)14-26-8-10-27(11-9-26)18-13-25-29(21(30)20(18)24)16-4-2-1-3-5-16/h1-7,12-13H,8-11,14H2 |
| InChIKey | ARXOKAUGYFUGFQ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 59.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.40 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|