C19H20N4O3S — CID 47089146
3-[4-[(2-sulfanylidene-1,3-benzoxazol-3-yl)methyl]-1,4-diazepane-1-carbonyl]-1H-pyridin-2-one (PubChem CID 47089146) has the molecular formula C19H20N4O3S and a molecular weight of 384.46 g/mol. Its IUPAC name is 3-[4-[(2-sulfanylidene-1,3-benzoxazol-3-yl)methyl]-1,4-diazepane-1-carbonyl]-1H-pyridin-2-one.
| Compound Name | 3-[4-[(2-sulfanylidene-1,3-benzoxazol-3-yl)methyl]-1,4-diazepane-1-carbonyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 47089146 |
| Molecular Formula | C19H20N4O3S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 3-[4-[(2-sulfanylidene-1,3-benzoxazol-3-yl)methyl]-1,4-diazepane-1-carbonyl]-1H-pyridin-2-one |
| SMILES | O=C(c1ccc[nH]c1=O)N1CCCN(Cn2c(=S)oc3ccccc32)CC1 |
| InChI | InChI=1S/C19H20N4O3S/c24-17-14(5-3-8-20-17)18(25)22-10-4-9-21(11-12-22)13-23-15-6-1-2-7-16(15)26-19(23)27/h1-3,5-8H,4,9-13H2,(H,20,24) |
| InChIKey | HLNGYAXVXPCLFM-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|