C19H21N5O2 — CID 9232425
(3S)-3-phenyl-1-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]pyrrolidine-2,5-dione (PubChem CID 9232425) has the molecular formula C19H21N5O2 and a molecular weight of 351.41 g/mol. Its IUPAC name is (3S)-3-phenyl-1-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]pyrrolidine-2,5-dione.
| Compound Name | (3S)-3-phenyl-1-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 9232425 |
| Molecular Formula | C19H21N5O2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | (3S)-3-phenyl-1-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@@H](c2ccccc2)C(=O)N1CN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C19H21N5O2/c25-17-13-16(15-5-2-1-3-6-15)18(26)24(17)14-22-9-11-23(12-10-22)19-20-7-4-8-21-19/h1-8,16H,9-14H2/t16-/m0/s1 |
| InChIKey | BSTPIYFMZFRKLU-INIZCTEOSA-N |
| XLogP | 1.10 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|