C23H34O8 — CID 22239600
2-[1,3-bis[(2-methylpropan-2-yl)oxy]-1,3-dioxopropan-2-yl]oxycarbonyladamantane-1-carboxylic acid (PubChem CID 22239600) has the molecular formula C23H34O8 and a molecular weight of 438.52 g/mol. Its IUPAC name is 2-[1,3-bis[(2-methylpropan-2-yl)oxy]-1,3-dioxopropan-2-yl]oxycarbonyladamantane-1-carboxylic acid.
| Compound Name | 2-[1,3-bis[(2-methylpropan-2-yl)oxy]-1,3-dioxopropan-2-yl]oxycarbonyladamantane-1-carboxylic acid |
|---|---|
| PubChem CID | 22239600 |
| Molecular Formula | C23H34O8 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 2-[1,3-bis[(2-methylpropan-2-yl)oxy]-1,3-dioxopropan-2-yl]oxycarbonyladamantane-1-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)C(OC(=O)C1C2CC3CC(C2)CC1(C(=O)O)C3)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H34O8/c1-21(2,3)30-18(25)16(19(26)31-22(4,5)6)29-17(24)15-14-8-12-7-13(9-14)11-23(15,10-12)20(27)28/h12-16H,7-11H2,1-6H3,(H,27,28) |
| InChIKey | QCTNIVCKYGUWHY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|